C15H13BrClNO3 — CID 5298469
2-bromo-N-(2-chlorophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide (PubChem CID 5298469) has the molecular formula C15H13BrClNO3 and a molecular weight of 370.63 g/mol. Its IUPAC name is 2-bromo-N-(2-chlorophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide.
| Compound Name | 2-bromo-N-(2-chlorophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
|---|---|
| PubChem CID | 5298469 |
| Molecular Formula | C15H13BrClNO3 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2-bromo-N-(2-chlorophenyl)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)C1C2CC3C(OC(=O)C31)C2Br |
| InChI | InChI=1S/C15H13BrClNO3/c16-12-6-5-7-11(15(20)21-13(7)12)10(6)14(19)18-9-4-2-1-3-8(9)17/h1-4,6-7,10-13H,5H2,(H,18,19) |
| InChIKey | IHRKASQQGMYREB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|