About 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride
4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride (PubChem CID 52985853) has the molecular formula C18H16ClNO5S
and a molecular weight of 393.85 g/mol. Its IUPAC name is 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride |
| PubChem CID | 52985853 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride |
| SMILES | CCc1cc(S(=O)(=O)Cl)ccc1OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16ClNO5S/c1-2-12-11-13(26(19,23)24)7-8-16(12)25-10-9-20-17(21)14-5-3-4-6-15(14)18(20)22/h3-8,11H,2,9-10H2,1H3 |
| InChIKey | SSQVDDMCFFXHRZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride?
The IUPAC name of 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride (CID 52985853) is 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride.
What is the SMILES notation for 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride?
The canonical SMILES for 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride is CCc1cc(S(=O)(=O)Cl)ccc1OCCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride?
The InChIKey is SSQVDDMCFFXHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClNO5S/c1-2-12-11-13(26(19,23)24)7-8-16(12)25-10-9-20-17(21)14-5-3-4-6-15(14)18(20)22/h3-8,11H,2,9-10H2,1H3.
What are the key properties of 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride?
4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride has a molecular weight of 393.85 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-ethylbenzenesulfonyl chloride is sourced from PubChem (CID 52985853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).