C25H24N4O — CID 5298698
4-[4-(4-tert-butylanilino)phthalazin-1-yl]benzamide (PubChem CID 5298698) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[4-(4-tert-butylanilino)phthalazin-1-yl]benzamide.
| Compound Name | 4-[4-(4-tert-butylanilino)phthalazin-1-yl]benzamide |
|---|---|
| PubChem CID | 5298698 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-[4-(4-tert-butylanilino)phthalazin-1-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(Nc2nnc(-c3ccc(C(N)=O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O/c1-25(2,3)18-12-14-19(15-13-18)27-24-21-7-5-4-6-20(21)22(28-29-24)16-8-10-17(11-9-16)23(26)30/h4-15H,1-3H3,(H2,26,30)(H,27,29) |
| InChIKey | FIQNADOCRLODMD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |