About N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide
N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide (PubChem CID 5298752) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide |
| PubChem CID | 5298752 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(O)Cn2nc(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C17H23N3O3/c1-11-12(2)19-20(13(11)3)9-16(22)10-23-17-7-5-15(6-8-17)18-14(4)21/h5-8,16,22H,9-10H2,1-4H3,(H,18,21) |
| InChIKey | HTYZRLHIALAGLS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide?
The IUPAC name of N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide (CID 5298752) is N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide.
What is the SMILES notation for N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide?
The canonical SMILES for N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide is CC(=O)Nc1ccc(OCC(O)Cn2nc(C)c(C)c2C)cc1.
What is the InChIKey of N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide?
The InChIKey is HTYZRLHIALAGLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-11-12(2)19-20(13(11)3)9-16(22)10-23-17-7-5-15(6-8-17)18-14(4)21/h5-8,16,22H,9-10H2,1-4H3,(H,18,21).
What are the key properties of N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide?
N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide has a molecular weight of 317.39 g/mol, XLogP of 2.21, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-hydroxy-3-(3,4,5-trimethylpyrazol-1-yl)propoxy]phenyl]acetamide is sourced from PubChem (CID 5298752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).