About 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone
2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone (PubChem CID 5298758) has the molecular formula C10H6Cl2FN3O
and a molecular weight of 274.08 g/mol. Its IUPAC name is 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone.
Molecular Properties
| Compound Name | 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone |
| PubChem CID | 5298758 |
| Molecular Formula | C10H6Cl2FN3O |
| Molecular Weight | 274.08 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cn1nc(Cl)nc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H6Cl2FN3O/c11-9-14-10(12)16(15-9)5-8(17)6-1-3-7(13)4-2-6/h1-4H,5H2 |
| InChIKey | BLQDBBRYMUISRT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.08 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone?
The IUPAC name of 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone (CID 5298758) is 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone.
What is the SMILES notation for 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone?
The canonical SMILES for 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone is O=C(Cn1nc(Cl)nc1Cl)c1ccc(F)cc1.
What is the InChIKey of 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone?
The InChIKey is BLQDBBRYMUISRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2FN3O/c11-9-14-10(12)16(15-9)5-8(17)6-1-3-7(13)4-2-6/h1-4H,5H2.
What are the key properties of 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone?
2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone has a molecular weight of 274.08 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-1,2,4-triazol-1-yl)-1-(4-fluorophenyl)ethanone is sourced from PubChem (CID 5298758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).