About O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate
O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate (PubChem CID 52987764) has the molecular formula C10H8OS3
and a molecular weight of 240.37 g/mol. Its IUPAC name is O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate.
Molecular Properties
| Compound Name | O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate |
| PubChem CID | 52987764 |
| Molecular Formula | C10H8OS3 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate |
| SMILES | C/C=C/C1=CC=C(OC=S)C(=S)C1=S |
| InChI | InChI=1S/C10H8OS3/c1-2-3-7-4-5-8(11-6-12)10(14)9(7)13/h2-6H,1H3/b3-2+ |
| InChIKey | AIQOPQLHNJRCLV-NSCUHMNNSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate?
The IUPAC name of O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate (CID 52987764) is O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate.
What is the SMILES notation for O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate?
The canonical SMILES for O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate is C/C=C/C1=CC=C(OC=S)C(=S)C1=S.
What is the InChIKey of O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate?
The InChIKey is AIQOPQLHNJRCLV-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H8OS3/c1-2-3-7-4-5-8(11-6-12)10(14)9(7)13/h2-6H,1H3/b3-2+.
What are the key properties of O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate?
O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate has a molecular weight of 240.37 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[4-[(E)-prop-1-enyl]-5,6-bis(sulfanylidene)cyclohexa-1,3-dien-1-yl] methanethioate is sourced from PubChem (CID 52987764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).