About 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine
4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine (PubChem CID 52987827) has the molecular formula C6H4Cl2N4
and a molecular weight of 203.03 g/mol. Its IUPAC name is 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 52987827 |
| Molecular Formula | C6H4Cl2N4 |
| Molecular Weight | 203.03 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1[nH]nc2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C6H4Cl2N4/c1-2-3-4(7)9-6(8)10-5(3)12-11-2/h1H3,(H,9,10,11,12) |
| InChIKey | WAVYWHRLGFPXMJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.03 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine (CID 52987827) is 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine is Cc1[nH]nc2nc(Cl)nc(Cl)c12.
What is the InChIKey of 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is WAVYWHRLGFPXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2N4/c1-2-3-4(7)9-6(8)10-5(3)12-11-2/h1H3,(H,9,10,11,12).
What are the key properties of 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine?
4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 203.03 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-3-methyl-2H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 52987827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).