C8H10N2O2 — CID 52987921
6-methyl-1,5-dihydroimidazo[1,2-a]pyridine-5,7-diol (PubChem CID 52987921) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 6-methyl-1,5-dihydroimidazo[1,2-a]pyridine-5,7-diol.
| Compound Name | 6-methyl-1,5-dihydroimidazo[1,2-a]pyridine-5,7-diol |
|---|---|
| PubChem CID | 52987921 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 6-methyl-1,5-dihydroimidazo[1,2-a]pyridine-5,7-diol |
| SMILES | CC1=C(O)C=C2NC=CN2C1O |
| InChI | InChI=1S/C8H10N2O2/c1-5-6(11)4-7-9-2-3-10(7)8(5)12/h2-4,8-9,11-12H,1H3 |
| InChIKey | JHWXQDFWFRQHGP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |