About (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride
(5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride (PubChem CID 52988119) has the molecular formula C4H9ClN4
and a molecular weight of 148.60 g/mol. Its IUPAC name is (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride |
| PubChem CID | 52988119 |
| Molecular Formula | C4H9ClN4 |
| Molecular Weight | 148.60 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride |
| SMILES | Cc1nc(CN)n[nH]1.Cl |
| InChI | InChI=1S/C4H8N4.ClH/c1-3-6-4(2-5)8-7-3;/h2,5H2,1H3,(H,6,7,8);1H |
| InChIKey | VFMTZNPHTFXKJK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.60 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The IUPAC name of (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride (CID 52988119) is (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The canonical SMILES for (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride is Cc1nc(CN)n[nH]1.Cl.
What is the InChIKey of (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The InChIKey is VFMTZNPHTFXKJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4.ClH/c1-3-6-4(2-5)8-7-3;/h2,5H2,1H3,(H,6,7,8);1H.
What are the key properties of (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride?
(5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride has a molecular weight of 148.60 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1H-1,2,4-triazol-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 52988119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).