About 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide
3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide (PubChem CID 52988857) has the molecular formula C11H16F3N5O2S
and a molecular weight of 339.34 g/mol. Its IUPAC name is 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide |
| PubChem CID | 52988857 |
| Molecular Formula | C11H16F3N5O2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide |
| SMILES | CC1NNC(C)C1S(=O)(=O)NNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C11H16F3N5O2S/c1-6-10(7(2)17-16-6)22(20,21)19-18-9-4-3-8(5-15-9)11(12,13)14/h3-7,10,16-17,19H,1-2H3,(H,15,18) |
| InChIKey | XWUWLNFAZFCSBA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide?
The IUPAC name of 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide (CID 52988857) is 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide.
What is the SMILES notation for 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide?
The canonical SMILES for 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide is CC1NNC(C)C1S(=O)(=O)NNc1ccc(C(F)(F)F)cn1.
What is the InChIKey of 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide?
The InChIKey is XWUWLNFAZFCSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N5O2S/c1-6-10(7(2)17-16-6)22(20,21)19-18-9-4-3-8(5-15-9)11(12,13)14/h3-7,10,16-17,19H,1-2H3,(H,15,18).
What are the key properties of 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide?
3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide has a molecular weight of 339.34 g/mol, XLogP of 0.60, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N'-[5-(trifluoromethyl)-2-pyridinyl]pyrazolidine-4-sulfonohydrazide is sourced from PubChem (CID 52988857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).