C23H21N3O5 — CID 52988982
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate (PubChem CID 52988982) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 52988982 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 2-(1,3-dioxoisoindol-2-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OCc1nnc(-c2ccccc2)o1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H21N3O5/c1-14(2)12-18(26-21(27)16-10-6-7-11-17(16)22(26)28)23(29)30-13-19-24-25-20(31-19)15-8-4-3-5-9-15/h3-11,14,18H,12-13H2,1-2H3 |
| InChIKey | PSKAHEUAJHIQFJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|