C16H21FN4O3 — CID 52989144
N-[1-(2-fluorophenyl)ethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 52989144) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is N-[1-(2-fluorophenyl)ethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(2-fluorophenyl)ethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 52989144 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[1-(2-fluorophenyl)ethyl]-5-nitro-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CC(NC(=O)C1NNC2CCC([N+](=O)[O-])CC21)c1ccccc1F |
| InChI | InChI=1S/C16H21FN4O3/c1-9(11-4-2-3-5-13(11)17)18-16(22)15-12-8-10(21(23)24)6-7-14(12)19-20-15/h2-5,9-10,12,14-15,19-20H,6-8H2,1H3,(H,18,22) |
| InChIKey | BVTGUAWPPPZTFK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|