C17H24FN3O3 — CID 52989273
[2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(4-fluorophenyl)pyrazolidine-3-carboxylate (PubChem CID 52989273) has the molecular formula C17H24FN3O3 and a molecular weight of 337.40 g/mol. Its IUPAC name is [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(4-fluorophenyl)pyrazolidine-3-carboxylate.
| Compound Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(4-fluorophenyl)pyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 52989273 |
| Molecular Formula | C17H24FN3O3 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [2-(3-methylbutan-2-ylamino)-2-oxoethyl] 5-(4-fluorophenyl)pyrazolidine-3-carboxylate |
| SMILES | CC(C)C(C)NC(=O)COC(=O)C1CC(c2ccc(F)cc2)NN1 |
| InChI | InChI=1S/C17H24FN3O3/c1-10(2)11(3)19-16(22)9-24-17(23)15-8-14(20-21-15)12-4-6-13(18)7-5-12/h4-7,10-11,14-15,20-21H,8-9H2,1-3H3,(H,19,22) |
| InChIKey | CYYHYPRJWFUHJY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |