C22H29FN4O — CID 52989736
1-[5-[5-(3-fluorophenyl)pyrazolidin-3-yl]pentyl]-1-methyl-3-phenylurea (PubChem CID 52989736) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 1-[5-[5-(3-fluorophenyl)pyrazolidin-3-yl]pentyl]-1-methyl-3-phenylurea.
| Compound Name | 1-[5-[5-(3-fluorophenyl)pyrazolidin-3-yl]pentyl]-1-methyl-3-phenylurea |
|---|---|
| PubChem CID | 52989736 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-[5-[5-(3-fluorophenyl)pyrazolidin-3-yl]pentyl]-1-methyl-3-phenylurea |
| SMILES | CN(CCCCCC1CC(c2cccc(F)c2)NN1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H29FN4O/c1-27(22(28)24-19-11-4-2-5-12-19)14-7-3-6-13-20-16-21(26-25-20)17-9-8-10-18(23)15-17/h2,4-5,8-12,15,20-21,25-26H,3,6-7,13-14,16H2,1H3,(H,24,28) |
| InChIKey | YDKFXTLNGBDTIE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|