About 6-methyltetradecane
6-methyltetradecane (PubChem CID 529900) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 6-methyltetradecane.
Molecular Properties
| Compound Name | 6-methyltetradecane |
| PubChem CID | 529900 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 6-methyltetradecane |
| SMILES | CCCCCCCCC(C)CCCCC |
| InChI | InChI=1S/C15H32/c1-4-6-8-9-10-12-14-15(3)13-11-7-5-2/h15H,4-14H2,1-3H3 |
| InChIKey | ONQXEQPEKDADGM-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyltetradecane?
The IUPAC name of 6-methyltetradecane (CID 529900) is 6-methyltetradecane.
What is the SMILES notation for 6-methyltetradecane?
The canonical SMILES for 6-methyltetradecane is CCCCCCCCC(C)CCCCC.
What is the InChIKey of 6-methyltetradecane?
The InChIKey is ONQXEQPEKDADGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32/c1-4-6-8-9-10-12-14-15(3)13-11-7-5-2/h15H,4-14H2,1-3H3.
What are the key properties of 6-methyltetradecane?
6-methyltetradecane has a molecular weight of 212.42 g/mol, XLogP of 5.95, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyltetradecane is sourced from PubChem (CID 529900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).