C12H11Cl2N7S — CID 5299085
3-[[2-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]methyl]-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 5299085) has the molecular formula C12H11Cl2N7S and a molecular weight of 356.24 g/mol. Its IUPAC name is 3-[[2-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]methyl]-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[[2-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 5299085 |
| Molecular Formula | C12H11Cl2N7S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 3-[[2-[(2,4-dichlorophenyl)methyl]tetrazol-5-yl]methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(Cc2nnn(Cc3ccc(Cl)cc3Cl)n2)n[nH]c1=S |
| InChI | InChI=1S/C12H11Cl2N7S/c1-20-11(16-17-12(20)22)5-10-15-19-21(18-10)6-7-2-3-8(13)4-9(7)14/h2-4H,5-6H2,1H3,(H,17,22) |
| InChIKey | ZWSYPQBMYGONFV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|