C19H27N5O — CID 52991285
N-[(1-ethylbenzimidazol-2-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 52991285) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 52991285 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | CCn1c(CN(C)C(=O)C2NNC3CCCCC32)nc2ccccc21 |
| InChI | InChI=1S/C19H27N5O/c1-3-24-16-11-7-6-10-15(16)20-17(24)12-23(2)19(25)18-13-8-4-5-9-14(13)21-22-18/h6-7,10-11,13-14,18,21-22H,3-5,8-9,12H2,1-2H3 |
| InChIKey | FRRVQOXKBVEKJZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |