C26H27NO6 — CID 5299173
ethyl 4-(2,3-dimethoxyphenyl)-2,5-dioxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate (PubChem CID 5299173) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is ethyl 4-(2,3-dimethoxyphenyl)-2,5-dioxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate.
| Compound Name | ethyl 4-(2,3-dimethoxyphenyl)-2,5-dioxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 5299173 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | ethyl 4-(2,3-dimethoxyphenyl)-2,5-dioxo-7-phenyl-1,3,4,6,7,8-hexahydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C2=C(CC1c1ccccc1)NC(=O)CC2c1cccc(OC)c1OC |
| InChI | InChI=1S/C26H27NO6/c1-4-33-26(30)23-17(15-9-6-5-7-10-15)13-19-22(24(23)29)18(14-21(28)27-19)16-11-8-12-20(31-2)25(16)32-3/h5-12,17-18,23H,4,13-14H2,1-3H3,(H,27,28) |
| InChIKey | MWLRCCCTLRNUCD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|