C4HBr2F5 — CID 52991882
(Z)-1,2-dibromo-1,1,4,4,4-pentafluorobut-2-ene (PubChem CID 52991882) has the molecular formula C4HBr2F5 and a molecular weight of 303.85 g/mol. Its IUPAC name is (Z)-1,2-dibromo-1,1,4,4,4-pentafluorobut-2-ene.
| Compound Name | (Z)-1,2-dibromo-1,1,4,4,4-pentafluorobut-2-ene |
|---|---|
| PubChem CID | 52991882 |
| Molecular Formula | C4HBr2F5 |
| Molecular Weight | 303.85 g/mol |
| Exact Mass | 301.84 |
| IUPAC Name | (Z)-1,2-dibromo-1,1,4,4,4-pentafluorobut-2-ene |
| SMILES | FC(F)(F)/C=C(\Br)C(F)(F)Br |
| InChI | InChI=1S/C4HBr2F5/c5-2(4(6,10)11)1-3(7,8)9/h1H/b2-1- |
| InChIKey | VDBSJDJYQXHGCV-UPHRSURJSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|