C9H4F5N3O2 — CID 52991962
6-nitro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole (PubChem CID 52991962) has the molecular formula C9H4F5N3O2 and a molecular weight of 281.14 g/mol. Its IUPAC name is 6-nitro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole.
| Compound Name | 6-nitro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 52991962 |
| Molecular Formula | C9H4F5N3O2 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 6-nitro-2-(1,1,2,2,2-pentafluoroethyl)-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2nc(C(F)(F)C(F)(F)F)[nH]c2c1 |
| InChI | InChI=1S/C9H4F5N3O2/c10-8(11,9(12,13)14)7-15-5-2-1-4(17(18)19)3-6(5)16-7/h1-3H,(H,15,16) |
| InChIKey | JEOWEMPCQGMUDQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|