About 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide
1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 5299219) has the molecular formula C15H11F3N4O2
and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| PubChem CID | 5299219 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)cc1C(=O)Nc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C15H11F3N4O2/c1-22-11(8-13(21-22)15(16,17)18)14(23)20-10-4-2-9(3-5-10)12-6-7-19-24-12/h2-8H,1H3,(H,20,23) |
| InChIKey | FWZYWSYFURWQMH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide?
The IUPAC name of 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (CID 5299219) is 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
What is the SMILES notation for 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide?
The canonical SMILES for 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide is Cn1nc(C(F)(F)F)cc1C(=O)Nc1ccc(-c2ccno2)cc1.
What is the InChIKey of 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide?
The InChIKey is FWZYWSYFURWQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N4O2/c1-22-11(8-13(21-22)15(16,17)18)14(23)20-10-4-2-9(3-5-10)12-6-7-19-24-12/h2-8H,1H3,(H,20,23).
What are the key properties of 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide?
1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide has a molecular weight of 336.27 g/mol, XLogP of 3.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[4-(1,2-oxazol-5-yl)phenyl]-3-(trifluoromethyl)pyrazole-5-carboxamide is sourced from PubChem (CID 5299219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).