C17H13F4N5O — CID 5299255
N-[(4-fluorophenyl)methyl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide (PubChem CID 5299255) has the molecular formula C17H13F4N5O and a molecular weight of 379.32 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 5299255 |
| Molecular Formula | C17H13F4N5O |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[5-[3-(trifluoromethyl)phenyl]tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2cccc(C(F)(F)F)c2)n1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F4N5O/c18-14-6-4-11(5-7-14)9-22-15(27)10-26-24-16(23-25-26)12-2-1-3-13(8-12)17(19,20)21/h1-8H,9-10H2,(H,22,27) |
| InChIKey | OPGFWSYEBAXZBO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |