C18H21N7O2S2 — CID 52993054
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide (PubChem CID 52993054) has the molecular formula C18H21N7O2S2 and a molecular weight of 431.55 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52993054 |
| Molecular Formula | C18H21N7O2S2 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-[(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carboxamide |
| SMILES | CCSc1nnc(NC(=O)C2CCCN(Cc3nc(-c4ccncc4)no3)C2)s1 |
| InChI | InChI=1S/C18H21N7O2S2/c1-2-28-18-23-22-17(29-18)21-16(26)13-4-3-9-25(10-13)11-14-20-15(24-27-14)12-5-7-19-8-6-12/h5-8,13H,2-4,9-11H2,1H3,(H,21,22,26) |
| InChIKey | PJXQPJQAEJJHTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|