C25H37ClN2O — CID 52993132
3,3,5,7-tetramethyl-9-(octylamino)-2,4-dihydroacridin-1-one;hydrochloride (PubChem CID 52993132) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is 3,3,5,7-tetramethyl-9-(octylamino)-2,4-dihydroacridin-1-one;hydrochloride.
| Compound Name | 3,3,5,7-tetramethyl-9-(octylamino)-2,4-dihydroacridin-1-one;hydrochloride |
|---|---|
| PubChem CID | 52993132 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3,3,5,7-tetramethyl-9-(octylamino)-2,4-dihydroacridin-1-one;hydrochloride |
| SMILES | CCCCCCCCNc1c2c(nc3c(C)cc(C)cc13)CC(C)(C)CC2=O.Cl |
| InChI | InChI=1S/C25H36N2O.ClH/c1-6-7-8-9-10-11-12-26-24-19-14-17(2)13-18(3)23(19)27-20-15-25(4,5)16-21(28)22(20)24;/h13-14H,6-12,15-16H2,1-5H3,(H,26,27);1H |
| InChIKey | IDSOOYRMKQZFQR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|