C29H28N2O6S2 — CID 52993145
5-benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;naphthalene-2,6-disulfonic acid (PubChem CID 52993145) has the molecular formula C29H28N2O6S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is 5-benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;naphthalene-2,6-disulfonic acid.
| Compound Name | 5-benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;naphthalene-2,6-disulfonic acid |
|---|---|
| PubChem CID | 52993145 |
| Molecular Formula | C29H28N2O6S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 5-benzyl-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole;naphthalene-2,6-disulfonic acid |
| SMILES | CN1CCc2c(c3ccccc3n2Cc2ccccc2)C1.O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1 |
| InChI | InChI=1S/C19H20N2.C10H8O6S2/c1-20-12-11-19-17(14-20)16-9-5-6-10-18(16)21(19)13-15-7-3-2-4-8-15;11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h2-10H,11-14H2,1H3;1-6H,(H,11,12,13)(H,14,15,16) |
| InChIKey | KPVSYPYZUMHNKI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|