C17H22ClN3O2 — CID 52993463
(8E)-8-hydroxyimino-4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one;hydrochloride (PubChem CID 52993463) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is (8E)-8-hydroxyimino-4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one;hydrochloride.
| Compound Name | (8E)-8-hydroxyimino-4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one;hydrochloride |
|---|---|
| PubChem CID | 52993463 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (8E)-8-hydroxyimino-4,4-dimethyl-1,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),11,13-trien-6-one;hydrochloride |
| SMILES | CC1(C)CC(=O)C2=C(C1)N1CCn3cccc3C1C/C2=N\O.Cl |
| InChI | InChI=1S/C17H21N3O2.ClH/c1-17(2)9-14-16(15(21)10-17)11(18-22)8-13-12-4-3-5-19(12)6-7-20(13)14;/h3-5,13,22H,6-10H2,1-2H3;1H/b18-11+; |
| InChIKey | HCPVMRCFDWWIHK-NWBUNABESA-N |
| XLogP | 3.14 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|