C31H44ClNO3 — CID 52993897
benzyl-[[3-[2-[(5S)-5-methoxycarbonyl-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]furan-2-yl]methyl]-dimethylazanium chloride (PubChem CID 52993897) has the molecular formula C31H44ClNO3 and a molecular weight of 514.15 g/mol. Its IUPAC name is benzyl-[[3-[2-[(5S)-5-methoxycarbonyl-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]furan-2-yl]methyl]-dimethylazanium chloride.
| Compound Name | benzyl-[[3-[2-[(5S)-5-methoxycarbonyl-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]furan-2-yl]methyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 52993897 |
| Molecular Formula | C31H44ClNO3 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | benzyl-[[3-[2-[(5S)-5-methoxycarbonyl-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethyl]furan-2-yl]methyl]-dimethylazanium chloride |
| SMILES | C=C1CCC2C(C)(CCC[C@]2(C)C(=O)OC)C1CCc1ccoc1C[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C31H44NO3.ClH/c1-23-13-16-28-30(2,18-10-19-31(28,3)29(33)34-6)26(23)15-14-25-17-20-35-27(25)22-32(4,5)21-24-11-8-7-9-12-24;/h7-9,11-12,17,20,26,28H,1,10,13-16,18-19,21-22H2,2-6H3;1H/q+1;/p-1/t26?,28?,30?,31-;/m0./s1 |
| InChIKey | RQDGCMNXBIHAER-LIEHWRODSA-M |
| XLogP | 3.94 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|