C31H44ClNO10 — CID 52993961
[(1S,2R,3R,4S,5R,6S,8S,9S,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate;perchloric acid (PubChem CID 52993961) has the molecular formula C31H44ClNO10 and a molecular weight of 626.14 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S,8S,9S,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate;perchloric acid.
| Compound Name | [(1S,2R,3R,4S,5R,6S,8S,9S,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate;perchloric acid |
|---|---|
| PubChem CID | 52993961 |
| Molecular Formula | C31H44ClNO10 |
| Molecular Weight | 626.14 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S,8S,9S,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate;perchloric acid |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@]34C1[C@H](C[C@H]23)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@@H]1[C@H]2OC(=O)c1ccccc1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C31H43NO6.ClHO4/c1-5-32-16-29(17-35-2)12-11-24(37-4)31-20-13-19-22(36-3)15-30(34,21(27(31)32)14-23(29)31)25(20)26(19)38-28(33)18-9-7-6-8-10-18;2-1(3,4)5/h6-10,19-27,34H,5,11-17H2,1-4H3;(H,2,3,4,5)/t19-,20-,21+,22+,23-,24+,25-,26+,27?,29+,30+,31-;/m1./s1 |
| InChIKey | ANSXSOUZOOCZLP-IOOPUPHESA-N |
| XLogP | -0.73 |
| TPSA | 166.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.14 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |