About 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one
2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 52994313) has the molecular formula C17H15ClN2O2
and a molecular weight of 314.77 g/mol. Its IUPAC name is 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| PubChem CID | 52994313 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2C12CCNC2c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O2/c18-12-9-10(5-6-14(12)21)15-17(7-8-19-15)11-3-1-2-4-13(11)20-16(17)22/h1-6,9,15,19,21H,7-8H2,(H,20,22) |
| InChIKey | PXOBMSVOYCQXIQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one?
The IUPAC name of 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (CID 52994313) is 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
What is the SMILES notation for 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one?
The canonical SMILES for 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one is O=C1Nc2ccccc2C12CCNC2c1ccc(O)c(Cl)c1.
What is the InChIKey of 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one?
The InChIKey is PXOBMSVOYCQXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O2/c18-12-9-10(5-6-14(12)21)15-17(7-8-19-15)11-3-1-2-4-13(11)20-16(17)22/h1-6,9,15,19,21H,7-8H2,(H,20,22).
What are the key properties of 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one?
2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one has a molecular weight of 314.77 g/mol, XLogP of 2.97, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(3-chloro-4-hydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one is sourced from PubChem (CID 52994313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).