About 5-sulfanylhexan-2-one
5-sulfanylhexan-2-one (PubChem CID 529948) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is 5-sulfanylhexan-2-one.
Molecular Properties
| Compound Name | 5-sulfanylhexan-2-one |
| PubChem CID | 529948 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 5-sulfanylhexan-2-one |
| SMILES | CC(=O)CCC(C)S |
| InChI | InChI=1S/C6H12OS/c1-5(7)3-4-6(2)8/h6,8H,3-4H2,1-2H3 |
| InChIKey | GFUOWPYWXSTOFZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanylhexan-2-one?
The IUPAC name of 5-sulfanylhexan-2-one (CID 529948) is 5-sulfanylhexan-2-one.
What is the SMILES notation for 5-sulfanylhexan-2-one?
The canonical SMILES for 5-sulfanylhexan-2-one is CC(=O)CCC(C)S.
What is the InChIKey of 5-sulfanylhexan-2-one?
The InChIKey is GFUOWPYWXSTOFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS/c1-5(7)3-4-6(2)8/h6,8H,3-4H2,1-2H3.
What are the key properties of 5-sulfanylhexan-2-one?
5-sulfanylhexan-2-one has a molecular weight of 132.23 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanylhexan-2-one is sourced from PubChem (CID 529948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).