C14H16N8O4 — CID 5299485
N-(3-imidazol-1-ylpropyl)-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5299485) has the molecular formula C14H16N8O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5299485 |
| Molecular Formula | C14H16N8O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-[(5-methyl-3-nitropyrazol-1-yl)methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1Cc1noc(C(=O)NCCCn2ccnc2)n1 |
| InChI | InChI=1S/C14H16N8O4/c1-10-7-12(22(24)25)18-21(10)8-11-17-14(26-19-11)13(23)16-3-2-5-20-6-4-15-9-20/h4,6-7,9H,2-3,5,8H2,1H3,(H,16,23) |
| InChIKey | IUOCPVLSDUVRRZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|