C20H16Br2N4O2 — CID 5299501
6-(4-amino-3,5-dibromophenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 5299501) has the molecular formula C20H16Br2N4O2 and a molecular weight of 504.18 g/mol. Its IUPAC name is 6-(4-amino-3,5-dibromophenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 6-(4-amino-3,5-dibromophenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5299501 |
| Molecular Formula | C20H16Br2N4O2 |
| Molecular Weight | 504.18 g/mol |
| Exact Mass | 501.96 |
| IUPAC Name | 6-(4-amino-3,5-dibromophenyl)-1,3-dimethyl-5-phenylpyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n(-c3cc(Br)c(N)c(Br)c3)cc2n(C)c1=O |
| InChI | InChI=1S/C20H16Br2N4O2/c1-24-15-10-26(12-8-13(21)17(23)14(22)9-12)18(11-6-4-3-5-7-11)16(15)19(27)25(2)20(24)28/h3-10H,23H2,1-2H3 |
| InChIKey | UKSAAYSIOHMRRJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|