C12H19ClN4 — CID 52995010
2-[(7-methyl-1,2,3,4-tetrahydroquinolin-2-yl)methyl]guanidine;hydrochloride (PubChem CID 52995010) has the molecular formula C12H19ClN4 and a molecular weight of 254.76 g/mol. Its IUPAC name is 2-[(7-methyl-1,2,3,4-tetrahydroquinolin-2-yl)methyl]guanidine;hydrochloride.
| Compound Name | 2-[(7-methyl-1,2,3,4-tetrahydroquinolin-2-yl)methyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 52995010 |
| Molecular Formula | C12H19ClN4 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(7-methyl-1,2,3,4-tetrahydroquinolin-2-yl)methyl]guanidine;hydrochloride |
| SMILES | Cc1ccc2c(c1)NC(CN=C(N)N)CC2.Cl |
| InChI | InChI=1S/C12H18N4.ClH/c1-8-2-3-9-4-5-10(7-15-12(13)14)16-11(9)6-8;/h2-3,6,10,16H,4-5,7H2,1H3,(H4,13,14,15);1H |
| InChIKey | VHONFQNMRCGXOC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|