About (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride
(1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride (PubChem CID 52995250) has the molecular formula C5H10ClN3OS
and a molecular weight of 195.68 g/mol. Its IUPAC name is (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride |
| PubChem CID | 52995250 |
| Molecular Formula | C5H10ClN3OS |
| Molecular Weight | 195.68 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride |
| SMILES | CSc1nnc([C@H](C)N)o1.Cl |
| InChI | InChI=1S/C5H9N3OS.ClH/c1-3(6)4-7-8-5(9-4)10-2;/h3H,6H2,1-2H3;1H/t3-;/m0./s1 |
| InChIKey | HBZNTEYFNFZHEH-DFWYDOINSA-N |
| XLogP | 1.23 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.68 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride?
The IUPAC name of (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride (CID 52995250) is (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride.
What is the SMILES notation for (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride?
The canonical SMILES for (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride is CSc1nnc([C@H](C)N)o1.Cl.
What is the InChIKey of (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride?
The InChIKey is HBZNTEYFNFZHEH-DFWYDOINSA-N. The full InChI is InChI=1S/C5H9N3OS.ClH/c1-3(6)4-7-8-5(9-4)10-2;/h3H,6H2,1-2H3;1H/t3-;/m0./s1.
What are the key properties of (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride?
(1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride has a molecular weight of 195.68 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(5-methylsulfanyl-1,3,4-oxadiazol-2-yl)ethanamine;hydrochloride is sourced from PubChem (CID 52995250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).