About N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide
N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide (PubChem CID 52995491) has the molecular formula C6H17Br3N2
and a molecular weight of 356.93 g/mol. Its IUPAC name is N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide.
Molecular Properties
| Compound Name | N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide |
| PubChem CID | 52995491 |
| Molecular Formula | C6H17Br3N2 |
| Molecular Weight | 356.93 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide |
| SMILES | Br.Br.CN(C)CCNCCBr |
| InChI | InChI=1S/C6H15BrN2.2BrH/c1-9(2)6-5-8-4-3-7;;/h8H,3-6H2,1-2H3;2*1H |
| InChIKey | DJYHGMPVCVFQSM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.93 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide?
The IUPAC name of N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide (CID 52995491) is N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide.
What is the SMILES notation for N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide?
The canonical SMILES for N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide is Br.Br.CN(C)CCNCCBr.
What is the InChIKey of N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide?
The InChIKey is DJYHGMPVCVFQSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BrN2.2BrH/c1-9(2)6-5-8-4-3-7;;/h8H,3-6H2,1-2H3;2*1H.
What are the key properties of N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide?
N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide has a molecular weight of 356.93 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromoethyl)-N',N'-dimethylethane-1,2-diamine;dihydrobromide is sourced from PubChem (CID 52995491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).