C9H11N5O2 — CID 5299649
1,4,6-trimethyl-5-nitropyrazolo[3,4-b]pyridin-3-amine (PubChem CID 5299649) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is 1,4,6-trimethyl-5-nitropyrazolo[3,4-b]pyridin-3-amine.
| Compound Name | 1,4,6-trimethyl-5-nitropyrazolo[3,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 5299649 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 1,4,6-trimethyl-5-nitropyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Cc1nc2c(c(N)nn2C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11N5O2/c1-4-6-8(10)12-13(3)9(6)11-5(2)7(4)14(15)16/h1-3H3,(H2,10,12) |
| InChIKey | KYIZYSOAUSPUDI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|