About 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide
5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide (PubChem CID 52996917) has the molecular formula C3H3ClN4O2
and a molecular weight of 162.54 g/mol. Its IUPAC name is 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide |
| PubChem CID | 52996917 |
| Molecular Formula | C3H3ClN4O2 |
| Molecular Weight | 162.54 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NO)c1n[nH]c(Cl)n1 |
| InChI | InChI=1S/C3H3ClN4O2/c4-3-5-1(6-7-3)2(9)8-10/h10H,(H,8,9)(H,5,6,7) |
| InChIKey | FUHUDBAMAQACLV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.54 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide?
The IUPAC name of 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide (CID 52996917) is 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide is O=C(NO)c1n[nH]c(Cl)n1.
What is the InChIKey of 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide?
The InChIKey is FUHUDBAMAQACLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3ClN4O2/c4-3-5-1(6-7-3)2(9)8-10/h10H,(H,8,9)(H,5,6,7).
What are the key properties of 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide?
5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide has a molecular weight of 162.54 g/mol, XLogP of -0.42, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-hydroxy-1H-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 52996917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).