About 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride
3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride (PubChem CID 52997055) has the molecular formula C5H9Cl2N3O
and a molecular weight of 198.05 g/mol. Its IUPAC name is 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride |
| PubChem CID | 52997055 |
| Molecular Formula | C5H9Cl2N3O |
| Molecular Weight | 198.05 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride |
| SMILES | Cl.OCCCc1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C5H8ClN3O.ClH/c6-5-7-4(8-9-5)2-1-3-10;/h10H,1-3H2,(H,7,8,9);1H |
| InChIKey | NLVMZHOYJQTROO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.05 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The IUPAC name of 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride (CID 52997055) is 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride.
What is the SMILES notation for 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The canonical SMILES for 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride is Cl.OCCCc1nc(Cl)n[nH]1.
What is the InChIKey of 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
The InChIKey is NLVMZHOYJQTROO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN3O.ClH/c6-5-7-4(8-9-5)2-1-3-10;/h10H,1-3H2,(H,7,8,9);1H.
What are the key properties of 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride?
3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride has a molecular weight of 198.05 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-1H-1,2,4-triazol-5-yl)propan-1-ol;hydrochloride is sourced from PubChem (CID 52997055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).