About N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid
N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid (PubChem CID 52997124) has the molecular formula C7H18N2O6S
and a molecular weight of 258.30 g/mol. Its IUPAC name is N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid |
| PubChem CID | 52997124 |
| Molecular Formula | C7H18N2O6S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid |
| SMILES | C[C@]1(NO)CCCC[C@H]1NO.O=S(=O)(O)O |
| InChI | InChI=1S/C7H16N2O2.H2O4S/c1-7(9-11)5-3-2-4-6(7)8-10;1-5(2,3)4/h6,8-11H,2-5H2,1H3;(H2,1,2,3,4)/t6-,7+;/m1./s1 |
| InChIKey | SLRXSHAYHXGEGD-HHQFNNIRSA-N |
| XLogP | -0.01 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid?
The IUPAC name of N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid (CID 52997124) is N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid.
What is the SMILES notation for N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid?
The canonical SMILES for N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid is C[C@]1(NO)CCCC[C@H]1NO.O=S(=O)(O)O.
What is the InChIKey of N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid?
The InChIKey is SLRXSHAYHXGEGD-HHQFNNIRSA-N. The full InChI is InChI=1S/C7H16N2O2.H2O4S/c1-7(9-11)5-3-2-4-6(7)8-10;1-5(2,3)4/h6,8-11H,2-5H2,1H3;(H2,1,2,3,4)/t6-,7+;/m1./s1.
What are the key properties of N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid?
N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid has a molecular weight of 258.30 g/mol, XLogP of -0.01, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-(hydroxyamino)-1-methylcyclohexyl]hydroxylamine;sulfuric acid is sourced from PubChem (CID 52997124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).