C16H15BrN4O4S3 — CID 52997283
(2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl) N'-(4-sulfamoylphenyl)carbamimidothioate;hydrobromide (PubChem CID 52997283) has the molecular formula C16H15BrN4O4S3 and a molecular weight of 503.43 g/mol. Its IUPAC name is (2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl) N'-(4-sulfamoylphenyl)carbamimidothioate;hydrobromide.
| Compound Name | (2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl) N'-(4-sulfamoylphenyl)carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 52997283 |
| Molecular Formula | C16H15BrN4O4S3 |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 501.94 |
| IUPAC Name | (2,4-dioxo-3-phenyl-1,3-thiazolidin-5-yl) N'-(4-sulfamoylphenyl)carbamimidothioate;hydrobromide |
| SMILES | Br.N/C(=N\c1ccc(S(N)(=O)=O)cc1)SC1SC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H14N4O4S3.BrH/c17-15(19-10-6-8-12(9-7-10)27(18,23)24)25-14-13(21)20(16(22)26-14)11-4-2-1-3-5-11;/h1-9,14H,(H2,17,19)(H2,18,23,24);1H |
| InChIKey | VEQBKCAHKAIRGP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|