About 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride
2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride (PubChem CID 52997650) has the molecular formula C24H43ClN4O
and a molecular weight of 439.09 g/mol. Its IUPAC name is 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride |
| PubChem CID | 52997650 |
| Molecular Formula | C24H43ClN4O |
| Molecular Weight | 439.09 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride |
| SMILES | Cl.[H]/N=c1/n(CCN(CC)CC)c2ccccc2n1COCCCCCCCCCC |
| InChI | InChI=1S/C24H42N4O.ClH/c1-4-7-8-9-10-11-12-15-20-29-21-28-23-17-14-13-16-22(23)27(24(28)25)19-18-26(5-2)6-3;/h13-14,16-17,25H,4-12,15,18-21H2,1-3H3;1H/b25-24-; |
| InChIKey | QQZWDKSHMFZIJM-BJFQDICYSA-N |
| XLogP | 5.80 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.09 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride?
The IUPAC name of 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride (CID 52997650) is 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride.
What is the SMILES notation for 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride?
The canonical SMILES for 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride is Cl.[H]/N=c1/n(CCN(CC)CC)c2ccccc2n1COCCCCCCCCCC.
What is the InChIKey of 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride?
The InChIKey is QQZWDKSHMFZIJM-BJFQDICYSA-N. The full InChI is InChI=1S/C24H42N4O.ClH/c1-4-7-8-9-10-11-12-15-20-29-21-28-23-17-14-13-16-22(23)27(24(28)25)19-18-26(5-2)6-3;/h13-14,16-17,25H,4-12,15,18-21H2,1-3H3;1H/b25-24-;.
What are the key properties of 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride?
2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride has a molecular weight of 439.09 g/mol, XLogP of 5.80, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(decoxymethyl)-2-iminobenzimidazol-1-yl]-N,N-diethylethanamine;hydrochloride is sourced from PubChem (CID 52997650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).