About 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride
3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride (PubChem CID 52997744) has the molecular formula C17H30Cl2N2O
and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride |
| PubChem CID | 52997744 |
| Molecular Formula | C17H30Cl2N2O |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride |
| SMILES | CCN(CC)CCCC1(CN)OCCc2ccccc21.Cl.Cl |
| InChI | InChI=1S/C17H28N2O.2ClH/c1-3-19(4-2)12-7-11-17(14-18)16-9-6-5-8-15(16)10-13-20-17;;/h5-6,8-9H,3-4,7,10-14,18H2,1-2H3;2*1H |
| InChIKey | IVRWDGZPLZDSBE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride?
The IUPAC name of 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride (CID 52997744) is 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride.
What is the SMILES notation for 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride?
The canonical SMILES for 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride is CCN(CC)CCCC1(CN)OCCc2ccccc21.Cl.Cl.
What is the InChIKey of 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride?
The InChIKey is IVRWDGZPLZDSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O.2ClH/c1-3-19(4-2)12-7-11-17(14-18)16-9-6-5-8-15(16)10-13-20-17;;/h5-6,8-9H,3-4,7,10-14,18H2,1-2H3;2*1H.
What are the key properties of 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride?
3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride has a molecular weight of 349.35 g/mol, XLogP of 3.38, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(aminomethyl)-3,4-dihydroisochromen-1-yl]-N,N-diethylpropan-1-amine;dihydrochloride is sourced from PubChem (CID 52997744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).