About diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate
diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate (PubChem CID 52997745) has the molecular formula C16H27O9P
and a molecular weight of 394.36 g/mol. Its IUPAC name is diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate.
Molecular Properties
| Compound Name | diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate |
| PubChem CID | 52997745 |
| Molecular Formula | C16H27O9P |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(c1ccco1)P(=O)(OCC)OCC.O |
| InChI | InChI=1S/C16H25O8P.H2O/c1-5-20-15(17)13(16(18)21-6-2)14(12-10-9-11-22-12)25(19,23-7-3)24-8-4;/h9-11,13-14H,5-8H2,1-4H3;1H2 |
| InChIKey | KFHDCFMBNLJTDZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 132.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate?
The IUPAC name of diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate (CID 52997745) is diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate.
What is the SMILES notation for diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate?
The canonical SMILES for diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate is CCOC(=O)C(C(=O)OCC)C(c1ccco1)P(=O)(OCC)OCC.O.
What is the InChIKey of diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate?
The InChIKey is KFHDCFMBNLJTDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25O8P.H2O/c1-5-20-15(17)13(16(18)21-6-2)14(12-10-9-11-22-12)25(19,23-7-3)24-8-4;/h9-11,13-14H,5-8H2,1-4H3;1H2.
What are the key properties of diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate?
diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate has a molecular weight of 394.36 g/mol, XLogP of 2.50, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[diethoxyphosphoryl(furan-2-yl)methyl]propanedioate;hydrate is sourced from PubChem (CID 52997745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).