C14H17BrN4O4S — CID 52997881
dimethyl 11,13-dimethyl-8-thia-4,5,10-triaza-1-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,5-dicarboxylate bromide (PubChem CID 52997881) has the molecular formula C14H17BrN4O4S and a molecular weight of 417.29 g/mol. Its IUPAC name is dimethyl 11,13-dimethyl-8-thia-4,5,10-triaza-1-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,5-dicarboxylate bromide.
| Compound Name | dimethyl 11,13-dimethyl-8-thia-4,5,10-triaza-1-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,5-dicarboxylate bromide |
|---|---|
| PubChem CID | 52997881 |
| Molecular Formula | C14H17BrN4O4S |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | dimethyl 11,13-dimethyl-8-thia-4,5,10-triaza-1-azoniatricyclo[7.4.0.02,7]trideca-1(13),2(7),9,11-tetraene-4,5-dicarboxylate bromide |
| SMILES | COC(=O)N1Cc2sc3nc(C)cc(C)[n+]3c2CN1C(=O)OC.[Br-] |
| InChI | InChI=1S/C14H17N4O4S.BrH/c1-8-5-9(2)18-10-6-16(13(19)21-3)17(14(20)22-4)7-11(10)23-12(18)15-8;/h5H,6-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | WUEBYFUTBFXQIO-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 76.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|