About 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane]
2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] (PubChem CID 52997918) has the molecular formula C23H27NO3
and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane].
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] |
| PubChem CID | 52997918 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] |
| SMILES | CC1=NC2(CCCCCC2)Cc2ccccc21.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C16H21N.C7H6O3/c1-13-15-9-5-4-8-14(15)12-16(17-13)10-6-2-3-7-11-16;8-6-4-2-1-3-5(6)7(9)10/h4-5,8-9H,2-3,6-7,10-12H2,1H3;1-4,8H,(H,9,10) |
| InChIKey | OBGCKUWHWQYGNE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane]?
The IUPAC name of 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] (CID 52997918) is 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane].
What is the SMILES notation for 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane]?
The canonical SMILES for 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] is CC1=NC2(CCCCCC2)Cc2ccccc21.O=C(O)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane]?
The InChIKey is OBGCKUWHWQYGNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N.C7H6O3/c1-13-15-9-5-4-8-14(15)12-16(17-13)10-6-2-3-7-11-16;8-6-4-2-1-3-5(6)7(9)10/h4-5,8-9H,2-3,6-7,10-12H2,1H3;1-4,8H,(H,9,10).
What are the key properties of 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane]?
2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] has a molecular weight of 365.47 g/mol, XLogP of 5.24, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;1-methylspiro[4H-isoquinoline-3,1'-cycloheptane] is sourced from PubChem (CID 52997918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).