C21H24BrN3O2 — CID 52998894
4-N-benzyl-1-N-(4-bromophenyl)-4-methylpiperidine-1,4-dicarboxamide (PubChem CID 52998894) has the molecular formula C21H24BrN3O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 4-N-benzyl-1-N-(4-bromophenyl)-4-methylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-benzyl-1-N-(4-bromophenyl)-4-methylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 52998894 |
| Molecular Formula | C21H24BrN3O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-N-benzyl-1-N-(4-bromophenyl)-4-methylpiperidine-1,4-dicarboxamide |
| SMILES | CC1(C(=O)NCc2ccccc2)CCN(C(=O)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C21H24BrN3O2/c1-21(19(26)23-15-16-5-3-2-4-6-16)11-13-25(14-12-21)20(27)24-18-9-7-17(22)8-10-18/h2-10H,11-15H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | TZOZHPASTTWRGY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |