About ethyl 2-chloropentanoate
ethyl 2-chloropentanoate (PubChem CID 529993) has the molecular formula C7H13ClO2
and a molecular weight of 164.63 g/mol. Its IUPAC name is ethyl 2-chloropentanoate.
Molecular Properties
| Compound Name | ethyl 2-chloropentanoate |
| PubChem CID | 529993 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | ethyl 2-chloropentanoate |
| SMILES | CCCC(Cl)C(=O)OCC |
| InChI | InChI=1S/C7H13ClO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3 |
| InChIKey | ZAOIIUSDMKVQJW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-chloropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-chloropentanoate?
The IUPAC name of ethyl 2-chloropentanoate (CID 529993) is ethyl 2-chloropentanoate.
What is the SMILES notation for ethyl 2-chloropentanoate?
The canonical SMILES for ethyl 2-chloropentanoate is CCCC(Cl)C(=O)OCC.
What is the InChIKey of ethyl 2-chloropentanoate?
The InChIKey is ZAOIIUSDMKVQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3.
What are the key properties of ethyl 2-chloropentanoate?
ethyl 2-chloropentanoate has a molecular weight of 164.63 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-chloropentanoate is sourced from PubChem (CID 529993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).