C17H13N5S — CID 5299979
(8S,8aR)-6-amino-8-pyridin-4-yl-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile (PubChem CID 5299979) has the molecular formula C17H13N5S and a molecular weight of 319.39 g/mol. Its IUPAC name is (8S,8aR)-6-amino-8-pyridin-4-yl-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-6-amino-8-pyridin-4-yl-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 5299979 |
| Molecular Formula | C17H13N5S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (8S,8aR)-6-amino-8-pyridin-4-yl-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@H](c2ccncc2)[C@H]2CSCC=C12 |
| InChI | InChI=1S/C17H13N5S/c18-7-13-12-3-6-23-8-14(12)15(11-1-4-22-5-2-11)17(9-19,10-20)16(13)21/h1-5,14-15H,6,8,21H2/t14-,15+/m0/s1 |
| InChIKey | IMBBZTCELSDFQZ-LSDHHAIUSA-N |
| XLogP | 2.24 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|