About 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide
2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide (PubChem CID 52999806) has the molecular formula C21H19N5OS2
and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide |
| PubChem CID | 52999806 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide |
| SMILES | CN(Cc1ccccc1)c1nc2ncnc(SCC(=O)Nc3ccccc3)c2s1 |
| InChI | InChI=1S/C21H19N5OS2/c1-26(12-15-8-4-2-5-9-15)21-25-19-18(29-21)20(23-14-22-19)28-13-17(27)24-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,24,27) |
| InChIKey | LTWXVSOSXIPPDB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide?
The IUPAC name of 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide (CID 52999806) is 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide.
What is the SMILES notation for 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide?
The canonical SMILES for 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide is CN(Cc1ccccc1)c1nc2ncnc(SCC(=O)Nc3ccccc3)c2s1.
What is the InChIKey of 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide?
The InChIKey is LTWXVSOSXIPPDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N5OS2/c1-26(12-15-8-4-2-5-9-15)21-25-19-18(29-21)20(23-14-22-19)28-13-17(27)24-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H,24,27).
What are the key properties of 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide?
2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide has a molecular weight of 421.55 g/mol, XLogP of 4.45, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[benzyl(methyl)amino]-[1,3]thiazolo[4,5-d]pyrimidin-7-yl]sulfanyl]-N-phenylacetamide is sourced from PubChem (CID 52999806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).