About ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate
ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate (PubChem CID 53000485) has the molecular formula C16H16N4O3
and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate |
| PubChem CID | 53000485 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1nc(Nc2ccccc2C)c2c(C)noc2n1 |
| InChI | InChI=1S/C16H16N4O3/c1-4-22-16(21)14-18-13(12-10(3)20-23-15(12)19-14)17-11-8-6-5-7-9(11)2/h5-8H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | KJGWEKUTDKYGLZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate?
The IUPAC name of ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate (CID 53000485) is ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate.
What is the SMILES notation for ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate?
The canonical SMILES for ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate is CCOC(=O)c1nc(Nc2ccccc2C)c2c(C)noc2n1.
What is the InChIKey of ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate?
The InChIKey is KJGWEKUTDKYGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O3/c1-4-22-16(21)14-18-13(12-10(3)20-23-15(12)19-14)17-11-8-6-5-7-9(11)2/h5-8H,4H2,1-3H3,(H,17,18,19).
What are the key properties of ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate?
ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate has a molecular weight of 312.33 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-4-(2-methylanilino)-[1,2]oxazolo[5,4-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 53000485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).